![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| निदेशक अवार्ड .pdf | 2018-08-27 12:27 | 387K | |
| निदेशक अवार्ड.pdf | 2018-08-27 12:27 | 14M | |
| (CIRG-IS-01)Master List of Documents.pdf | 2019-05-02 17:07 | 129K | |
| (CIRG-IS-02)Customer_FeedBack.pdf | 2019-05-02 17:07 | 327K | |
| (CIRG-IS-03)Training Record.pdf | 2019-05-02 17:07 | 114K | |
| (CIRG-IS-04) Advances Bill.pdf | 2019-05-02 17:07 | 89K | |
| (CIRG-IS-05)Charge_Transfer_Certificate.pdf | 2019-05-02 17:07 | 263K | |
| (CIRG-IS-06)Non-Regular Leave Application.pdf | 2019-05-02 17:07 | 462K | |
| (CIRG-IS-07) Regular Leave Application.pdf | 2019-05-02 17:07 | 340K | |
| (CIRG-IS-08) Joining Report.pdf | 2019-05-02 17:07 | 244K | |
| (CIRG-IS-09) NewsPaper Reimbursement.pdf | 2019-05-02 17:07 | 355K | |
| (CIRG-IS-10) CEA Reimbursement.pdf | 2019-05-02 17:07 | 349K | |
| (CIRG-IS-11) LTC Application.pdf | 2019-05-02 17:07 | 267K | |
| (CIRG-IS-12) LTC Bill.pdf | 2019-05-02 17:07 | 379K | |
| (CIRG-IS-13) LTC Final Claim_Adjustment Form.pdf | 2019-05-02 17:07 | 254K | |
| (CIRG-IS-14) TA Form.pdf | 2019-05-02 17:07 | 265K | |
| (CIRG-IS-15) TA Bill.pdf | 2019-05-02 17:07 | 386K | |
| (CIRG-IS-16) TA Certificate.pdf | 2019-05-02 17:07 | 356K | |
| (CIRG-IS-17) TTA Bill.pdf | 2019-05-02 17:07 | 378K | |
| (CIRG-IS-18) Computer Advance Application.pdf | 2019-05-02 17:07 | 270K | |
| (CIRG-IS-19) House Building Advance Application.pdf | 2019-05-02 17:07 | 272K | |
| (CIRG-IS-20) No Dues Form.pdf | 2019-05-02 17:07 | 251K | |
| (CIRG-IS-21) Joint Declaration Form.pdf | 2019-05-02 17:07 | 261K | |
| (CIRG-IS-22) GPF Advance Application.pdf | 2019-05-02 17:07 | 353K | |
| (CIRG-IS-23) GPF Withdrawal Application.pdf | 2019-05-02 17:07 | 351K | |
| (CIRG-IS-24) GPF Conversion Application.pdf | 2019-05-02 17:07 | 345K | |
| (CIRG-IS-25) Medical Reimbursement Form (Outdoor).pdf | 2019-05-02 17:07 | 359K | |
| (CIRG-IS-26) Medical Reimbursement Form (Indoor).pdf | 2019-05-02 17:07 | 360K | |
| (CIRG-IS-27) Imprest Advance Form.pdf | 2019-05-02 17:07 | 268K | |
| (CIRG-IS-28) Monthly Remuneration Certificate.pdf | 2019-05-02 17:07 | 365K | |
| (CIRG-IS-29) Purchase Format (Individual).pdf | 2019-05-02 17:07 | 263K | |
| (CIRG-IS-30) Purchase Format (Committee).pdf | 2019-05-02 17:07 | 263K | |
| (CIRG-IS-31) Direct Purchase Indent Form.pdf | 2019-05-02 17:07 | 170K | |
| (CIRG-IS-32) Comparison Basis Purchase Indent Form.pdf | 2019-05-02 17:07 | 269K | |
| (CIRG-IS-33) Rate Contract Purchase Indent Form.pdf | 2019-05-02 17:07 | 272K | |
| (CIRG-IS-34) Travel Plan for LTC.pdf | 2019-06-03 10:38 | 172K | |
| 02092018msc1.pdf | 2019-01-09 14:45 | 175K | |
| 02092018msc2.pdf | 2019-01-09 14:45 | 175K | |
| 2nd_tender_serb.pdf | 2018-08-27 12:25 | 6.4M | |
| 2ndtendernicra.pdf | 2018-08-27 12:25 | 6.3M | |
| 12aicrp_meet.docx | 2018-08-27 12:27 | 16K | |
| 12aicrp_meet.pdf | 2018-08-27 12:27 | 223K | |
| 56th.pdf | 2018-08-27 12:26 | 363K | |
| 59thntsalectedcandidate03092014.pdf | 2018-08-27 12:25 | 304K | |
| 63nt.pdf | 2018-08-27 12:27 | 366K | |
| 63ntpfinallist.pdf | 2018-08-27 12:26 | 298K | |
| 64th_training-final-list.pdf | 2018-08-27 12:27 | 267K | |
| 64th_training-trainees-final-list.pdf | 2018-08-27 12:25 | 267K | |
| 64thntold.pdf | 2018-08-27 12:27 | 96K | |
| 65thntprogramme.pdf | 2018-08-27 12:27 | 482K | |
| 65thntselected.pdf | 2018-08-27 12:27 | 254K | |
| 67selected.pdf | 2018-08-27 12:27 | 292K | |
| 67th_Goat_Training.pdf | 2018-08-27 12:27 | 367K | |
| 68thtraining-final-list(1).pdf | 2018-08-27 12:25 | 1.5M | |
| 70th-note.pdf | 2018-08-27 12:25 | 189K | |
| 72 National Training Programme.pdf | 2018-08-27 12:26 | 417K | |
| 73nttraining.pdf | 2018-08-27 12:25 | 417K | |
| 73training.pdf | 2018-08-27 12:25 | 4.8K | |
| 77th NTP select Candidate.pdf | 2018-08-27 12:27 | 336K | |
| 79NET.pdf | 2018-12-17 14:25 | 396K | |
| 80thNTPSelectedCandidates.pdf | 2019-02-01 15:08 | 153K | |
| 81 trng.pdf | 2019-02-16 16:57 | 285K | |
| 95th 3rd Batch 23 to 27 August.pdf | 2022-08-20 14:41 | 11M | |
| 2024/ | 2024-02-29 10:39 | - | |
| ADMINISTRATIVE CIRCULARS.pdf | 2019-06-03 10:38 | 649K | |
| ATR Gandhi Jayanti 2019.pdf | 2019-10-07 16:44 | 1.2M | |
| Ajamukh January - June 2023.pdf | 2023-09-15 09:33 | 33M | |
| Ajamukh july-dec16.pdf | 2018-08-27 12:27 | 14M | |
| Ajamukh vol 38.pdf | 2020-02-20 14:47 | 13M | |
| Annual Report 2021_Final.pdf | 2022-08-05 09:38 | 374M | |
| Annual Report Hindi 2020.pdf | 2022-05-26 13:29 | 5.8M | |
| Annual_Report2015-16.pdf | 2018-08-27 12:27 | 48M | |
| Annual_report_2008_09.rar | 2018-08-27 12:27 | 150M | |
| Azamukh Mega issue 40.pdf | 2022-05-23 11:41 | 1.5M | |
| Brief Biodata of Director.pdf | 2018-08-27 12:27 | 174K | |
| CASUAL LEAVE.pdf | 2019-03-06 16:20 | 103K | |
| CIRG Annual Report 2019.pdf | 2021-01-21 14:41 | 65M | |
| CIRG English Newsletter Jan-June 2022.pdf | 2022-10-03 13:06 | 39M | |
| CIRG NEWS JAN to June 2023.pdf | 2023-10-11 16:40 | 37M | |
| CIRG SIGN/ | 2023-05-13 13:57 | - | |
| Calendar 2022.pdf | 2022-02-23 12:29 | 382K | |
| Calendar 2023.pdf | 2023-01-04 10:55 | 9.5M | |
| Circular_post_poned.pdf | 2018-12-06 11:59 | 374K | |
| Circular postponed.pdf | 2018-12-06 11:59 | 374K | |
| Commercializable Technologies CIRG.pdf | 2019-09-06 12:25 | 571K | |
| CommercializedTechnologies CIRG.pdf | 2019-09-23 17:01 | 622K | |
| Contract Notice for publish on Institute's website.pdf | 2022-02-23 16:37 | 2.1M | |
| DAPSC.pdf | 2021-07-02 14:38 | 1.6M | |
| DBT-2019.pdf | 2019-02-13 10:53 | 7.0M | |
| DGvisitnews26sep16.pdf | 2018-08-27 12:25 | 727K | |
| Desktop/ | 2019-11-20 12:42 | - | |
| EARNED LEAVE FORM.pdf | 2019-03-06 16:26 | 47K | |
| Equipment.pdf | 2018-08-13 11:36 | 268K | |
| Equipment details for website(Dr.V Rajkumar Lab) 2.pdf | 2018-08-13 11:36 | 268K | |
| Established BEETAL GOATS UNIT at ICAR write up for web revised.pdf | 2018-08-27 12:27 | 1.6M | |
| Estrus-Synchnonization.pdf | 2022-08-02 16:12 | 496K | |
| Fin. C.S..pdf | 2019-12-26 12:22 | 298K | |
| Final Annual Report 2020.pdf | 2022-03-22 14:35 | 26M | |
| Hindi_Annual_Report_09.pdf | 2018-08-27 12:25 | 51K | |
| IPR.pdf | 2018-08-27 12:27 | 630K | |
| Invitation_Card_Curve_Final.pdf | 2018-08-27 12:26 | 5.8M | |
| Krishi Unnati Mela 2017.pdf | 2018-08-27 12:25 | 397K | |
| LTC ADVANCE FORM - english.pdf | 2019-03-06 16:29 | 20K | |
| LTC ADVANCE FORM - hindi.pdf | 2019-03-06 16:30 | 162K | |
| List of eqipment facilities CIRG.pdf | 2018-08-27 12:25 | 229K | |
| List of usable technologies in pipeline.doc | 2018-08-27 12:27 | 51K | |
| MEDICAL & LTC DEPENDENT FORMS.pdf | 2019-03-06 16:31 | 84K | |
| MEDICAL ADVANCE.pdf | 2019-03-06 16:31 | 8.1K | |
| MEDICAL REIMBURSMENT FORM.pdf | 2019-03-06 16:32 | 97K | |
| MO-2016.pdf | 2018-08-27 12:25 | 282K | |
| Mahila Kisan Diwas Celebration 15.10.2020.pdf | 2020-10-15 15:55 | 442K | |
| Material distribution under DAPSC on 02.02.2021.pdf | 2021-02-05 16:58 | 84K | |
| News Hindi 11-4-19 Curve.pdf | 2019-04-26 13:04 | 11M | |
| Nitika.pdf | 2018-08-27 12:27 | 290K | |
| PENSION FORMS.pdf | 2019-03-06 16:34 | 453K | |
| PN Bhat Condolence-converted (3).pdf | 2020-06-12 15:53 | 53K | |
| Proteome.pdf | 2020-09-15 09:20 | 283K | |
| SALARY DETAIL.pdf | 2018-08-27 12:25 | 111K | |
| SCSP Programme at Farah 12.11.2020.pdf | 2020-11-28 06:20 | 964K | |
| SRF milk.pdf.pdf | 2019-12-30 11:42 | 1.1M | |
| Select Candidates list 21-28 October, 2017.pdf | 2018-08-27 12:25 | 271K | |
| Selected Candidates_List85 Training.pdf | 2019-09-27 11:06 | 205K | |
| Selected Candidates_List 86 Training.pdf | 2019-09-27 11:07 | 271K | |
| Selected Candidates_List 87 Training.pdf | 2019-09-27 11:12 | 503K | |
| Snap Edit.jpg | 2018-08-27 12:25 | 2.7M | |
| Sponsd_Training.pdf | 2018-08-27 12:27 | 41K | |
| TABILL FOR NON OFFICIAL.pdf | 2019-03-06 16:35 | 104K | |
| TA Bill Proforma.pdf | 2019-03-06 16:34 | 31K | |
| TENDER3.pdf | 2018-08-27 12:25 | 6.5M | |
| TENDER FORM for printing of annual report.docx | 2018-08-27 12:25 | 24K | |
| TOT.pdf | 2018-08-27 12:25 | 238K | |
| Technology/ | 2019-11-20 12:45 | - | |
| Tele_Directory CIRG updated13Aug16.pdf | 2018-08-27 12:27 | 611K | |
| Telephone Directory-CIRG.pdf | 2023-10-19 10:42 | 210K | |
| Telephone Directory-CIRG 2Apr2022.pdf | 2022-04-04 18:00 | 124K | |
| Telephone Directory of CIRG-New 30Jun2020.pdf | 2020-06-30 14:58 | 309K | |
| Tender_SERB-DST-Project16-17.pdf | 2018-08-27 12:27 | 11M | |
| Tender for Renovation of Female Reproduction Lab under NAIP.doc | 2018-08-27 12:26 | 41K | |
| WIRA-12.pdf | 2018-08-27 12:26 | 223K | |
| WIRA-121.pdf | 2018-08-27 12:25 | 198K | |
| aao.jpg | 2018-08-27 12:27 | 454K | |
| aao1.pdf | 2018-08-27 12:25 | 550K | |
| ac_tender.pdf | 2018-08-27 12:25 | 3.3M | |
| accommodation_form.html | 2018-08-27 12:27 | 20K | |
| accommodation_form.pdf | 2018-08-27 12:26 | 42K | |
| agmnews-2014.pdf | 2018-08-27 12:26 | 1.5M | |
| aicrp-young.pdf | 2018-08-27 12:26 | 802K | |
| aicrp.pdf | 2019-03-18 11:36 | 6.5M | |
| aicrp_g.pdf | 2018-08-27 12:26 | 25K | |
| ainp-serb.pdf | 2018-08-27 12:25 | 6.3M | |
| ajamukh.Jan-June2015.pdf | 2018-08-27 12:27 | 10M | |
| ajamukh.june 2017.pdf.pdf | 2018-08-27 12:27 | 12M | |
| ajamukh.pdf | 2018-08-27 12:25 | 8.1M | |
| ajamukh13.pdf | 2018-08-27 12:27 | 26M | |
| ajamukhnew.pdf | 2018-08-27 12:25 | 15M | |
| ajat_ajati.pdf | 2018-08-27 12:27 | 853K | |
| akg.pdf | 2018-08-27 12:27 | 62K | |
| akm_notice.pdf | 2021-07-01 12:53 | 2.1M | |
| akmishra.pdf | 2018-08-27 12:27 | 103K | |
| amarujalanews.pdf | 2018-08-27 12:27 | 4.7M | |
| amendment.jpg | 2018-08-27 12:25 | 350K | |
| anil kumar 2.pdf | 2020-05-12 14:36 | 424K | |
| anil kumar Mishra final.pdf | 2020-05-12 14:36 | 424K | |
| animsupply.pdf | 2018-08-27 12:27 | 110K | |
| annual10-11.pdf | 2019-02-01 15:13 | 6.2M | |
| annual11-12.pdf | 2019-02-01 15:15 | 46M | |
| annual_report_2007_08.rar | 2018-08-27 12:25 | 98M | |
| annual_report_2009_10.pdf | 2018-08-27 12:27 | 136M | |
| annual_report_tender15-16.pdf | 2018-08-27 12:27 | 86K | |
| annualrepors | 2018-08-27 12:25 | 26M | |
| annualreport | 2018-08-27 12:25 | 191K | |
| annual report cirg 2016-17.pdf | 2018-08-27 12:27 | 6.5M | |
| annualreports/ | 2023-03-01 11:05 | - | |
| anu.pdf | 2018-08-27 12:27 | 102K | |
| anu_tender.pdf | 2018-08-27 12:25 | 6.4M | |
| anualreports | 2018-08-27 12:27 | 7.6M | |
| aplform.pdf | 2018-08-27 12:27 | 56K | |
| application 85-87 ntp.pdf | 2019-09-03 14:43 | 567K | |
| application form.pdf | 2018-08-27 12:27 | 209K | |
| applicationform_interview.pdf | 2018-08-27 12:27 | 187K | |
| ar-15.pdf | 2018-08-27 12:25 | 20M | |
| ar067.pdf | 2018-08-27 12:27 | 1.4M | |
| ar8-9.pdf | 2010-03-11 21:18 | 17M | |
| ar1011.pdf | 2018-08-27 12:26 | 6.2M | |
| ar1012.pdf | 2018-08-27 12:25 | 46M | |
| arc-chemical-16-17.pdf | 2018-08-27 12:27 | 39K | |
| arc2018.pdf | 2018-08-27 12:27 | 410K | |
| arcchemical1516.pdf | 2018-08-27 12:27 | 192K | |
| arcchemicals.pdf | 2018-08-27 12:25 | 114K | |
| arcchemicals1516.pdf | 2018-08-27 12:27 | 114K | |
| arhar.pdf | 2018-08-27 12:25 | 60K | |
| arhar15.pdf | 2018-08-27 12:27 | 60K | |
| arharbhoosa.pdf | 2018-08-27 12:25 | 165K | |
| arharrevised.pdf | 2018-12-24 15:12 | 264K | |
| arhindi2015.pdf | 2018-08-27 12:27 | 16M | |
| arun.pdf | 2018-08-27 12:27 | 168K | |
| arvind.pdf | 2018-08-27 12:27 | 227K | |
| ashok.pdf | 2018-08-27 12:25 | 281K | |
| ashok_kumar.pdf | 2018-08-27 12:27 | 21K | |
| auction-june-23.pdf | 2023-06-09 09:36 | 2.9M | |
| auction2016.pdf | 2018-08-27 12:25 | 1.5M | |
| auction_16-17.pdf | 2018-08-27 12:27 | 29K | |
| august-tender-gpt1.pdf | 2018-08-27 12:25 | 877K | |
| award1_rafi_msc.pdf | 2018-08-27 12:25 | 388K | |
| award_rafi_msc.pdf | 2018-08-27 12:27 | 388K | |
| award_rajshri.pdf | 2018-08-27 12:26 | 98K | |
| awardiso.pdf | 2018-08-27 12:25 | 225K | |
| bacchu.pdf | 2018-08-27 12:26 | 514K | |
| bhoosha-sept-16.pdf | 2018-08-27 12:27 | 62K | |
| bhoosha16-17.pdf | 2018-08-27 12:25 | 60K | |
| bio/ | 2019-11-20 12:41 | - | |
| bio_data/ | 2024-01-18 14:56 | - | |
| brai.pdf | 2018-08-27 12:27 | 347K | |
| brainai.pdf | 2018-08-27 12:25 | 484K | |
| brajmohan.pdf | 2018-08-27 12:27 | 105K | |
| bsagr-proc.pdf | 2018-08-27 12:26 | 292K | |
| buat.jpg | 2018-08-27 12:25 | 1.5M | |
| cal-2017.pdf | 2018-08-27 12:27 | 508K | |
| cal-2018.pdf | 2018-09-14 15:26 | 534K | |
| cal-2019-hi.pdf | 2019-01-04 15:14 | 499K | |
| cal-2019.pdf | 2019-01-04 15:14 | 499K | |
| cal-2020.pdf | 2020-12-31 18:43 | 567K | |
| cal2013.pdf | 2018-08-27 12:27 | 153K | |
| cal2014.pdf | 2018-08-27 12:25 | 478K | |
| cctveoi2018.pdf | 2018-12-17 16:19 | 564K | |
| circular.pdf | 2020-08-19 17:16 | 1.3M | |
| cirg.newsjuly_dec2015.pdf | 2018-08-27 12:25 | 19M | |
| cirg.pdf | 2018-08-27 12:27 | 140K | |
| cirg_at_a_glance.pdf | 2018-08-27 12:25 | 1.2M | |
| cirgajamukh14.pdf | 2018-08-27 12:27 | 12M | |
| cirgbill.doc | 2018-08-27 12:27 | 14K | |
| cirgnews 21-6-17 .pdf | 2018-08-27 12:27 | 19M | |
| cirgnews_jan2016 | 2018-08-27 12:25 | 6.7M | |
| cirgnewsjan-june-2015.pdf | 2018-08-27 12:27 | 807K | |
| cirgnewsoct-17.pdf | 2018-08-27 12:25 | 26M | |
| cirgnl2014.pdf | 2018-08-27 12:27 | 9.9M | |
| cirgnlhindi.pdf | 2018-08-27 12:27 | 7.7M | |
| cirgrfd13-14.pdf | 2018-08-27 12:27 | 246K | |
| citizen-charter.pdf | 2018-08-27 12:25 | 107K | |
| civil.pdf | 2018-08-27 12:25 | 23K | |
| closing Ceremony.pdf | 2018-08-27 12:26 | 893K | |
| coimbt.pdf | 2018-08-27 12:25 | 503K | |
| constitution day_CIRG_26 Nov 2021.pdf | 2021-11-27 10:29 | 324K | |
| contract.pdf | 2018-08-27 12:25 | 350K | |
| corrigendum.jpg | 2018-08-27 12:25 | 691K | |
| custom.pdf | 2018-08-27 12:27 | 100K | |
| dapsc.pdf | 2020-10-08 11:16 | 192K | |
| dateofextention.pdf | 2018-08-27 12:25 | 9.8K | |
| ddg-visit.pdf | 2018-08-27 12:25 | 1.0M | |
| december12.pdf | 2018-08-27 12:27 | 8.6M | |
| dir_circular.pdf | 2018-08-27 12:27 | 767K | |
| directory/ | 2023-12-11 16:39 | - | |
| directory1.pdf | 2020-06-30 13:14 | 309K | |
| dks-hindiaward.pdf | 2018-08-27 12:27 | 296K | |
| dksaward.pdf | 2018-08-27 12:25 | 296K | |
| doctor.pdf | 2018-08-27 12:27 | 570K | |
| documents/ | 2019-11-20 12:42 | - | |
| downloads/ | 2023-11-09 11:37 | - | |
| duties.pdf | 2018-08-27 12:27 | 628K | |
| e-tender16-17.pdf | 2018-08-27 12:27 | 6.5M | |
| education.pdf | 2018-08-27 12:25 | 123K | |
| eese.blade.php | 2018-08-27 12:27 | 2.2K | |
| emp.pdf | 2021-11-17 12:55 | 460K | |
| empl.pdf | 2023-06-19 15:08 | 23K | |
| fainallist.pdf | 2019-01-09 11:05 | 1.4M | |
| farmerpmevent18.pdf | 2018-08-27 12:26 | 1.0M | |
| farminovatorday.pdf | 2018-08-27 12:25 | 309K | |
| feed_16-17.pdf | 2018-08-27 12:25 | 6.2M | |
| feeder16-17.pdf | 2018-08-27 12:27 | 245K | |
| final_folder.pdf | 2018-08-27 12:27 | 351K | |
| finencial statement.pdf | 2018-08-27 12:27 | 494K | |
| folder.pdf | 2018-08-27 12:27 | 351K | |
| foundationday.pdf | 2018-08-27 12:27 | 130K | |
| foundationnews.pdf | 2018-08-27 12:27 | 1.0M | |
| gaite-corrigendum.pdf | 2018-08-27 12:25 | 1.2M | |
| goat_improvement.pdf | 2018-08-27 12:25 | 34K | |
| goatnews/ | 2019-11-20 12:42 | - | |
| gopaldas.pdf | 2018-08-27 12:27 | 17K | |
| gptclosingnews.pdf | 2018-08-27 12:26 | 739K | |
| gptclosingnews1.pdf | 2018-08-27 12:27 | 768K | |
| gpttraining.jpg | 2018-08-27 12:25 | 610K | |
| gptyp2.pdf | 2018-08-27 12:25 | 306K | |
| guptara.pdf | 2018-08-27 12:25 | 114K | |
| hcalender.pdf | 2018-08-27 12:25 | 363K | |
| hcalender18.pdf | 2018-08-27 12:27 | 610K | |
| hindiaward2015.pdf | 2018-08-27 12:27 | 323K | |
| hindinews18june18.pdf | 2018-08-27 12:26 | 585K | |
| hindipakhwada2014.pdf | 2018-08-27 12:27 | 242K | |
| holiday17.pdf | 2018-08-27 12:25 | 572K | |
| horticulture1.pdf | 2018-08-27 12:27 | 6.6M | |
| horticulture16.pdf | 2018-08-27 12:27 | 550K | |
| hotriculturetender15.pdf | 2018-08-27 12:27 | 54K | |
| hstatus.pdf | 2018-08-27 12:25 | 91K | |
| image | 2018-08-27 12:27 | 1.3K | |
| images/ | 2023-07-04 13:33 | - | |
| index_000.png | 2018-08-27 12:27 | 56K | |
| index_022.jpg | 2018-08-27 12:27 | 23K | |
| innovation.pdf | 2018-08-27 12:25 | 62K | |
| innovationday.pdf | 2018-08-27 12:25 | 57K | |
| innovatorsday-15.pdf | 2018-08-27 12:25 | 422K | |
| inter.pdf | 2019-01-05 11:56 | 344K | |
| interview-1.pdf | 2018-08-27 12:25 | 1.6M | |
| interview-dst.pdf | 2018-08-27 12:25 | 1.5M | |
| interview-dst1.pdf | 2018-08-27 12:27 | 1.5M | |
| interview-mo.pdf | 2018-08-27 12:27 | 1.6M | |
| interview-nasf.pdf | 2018-08-27 12:25 | 2.2M | |
| interview-skilled.pdf | 2018-08-27 12:27 | 1.8M | |
| interview-yp1.pdf | 2018-08-27 12:27 | 1.4M | |
| interview.pdf | 2018-08-27 12:27 | 229K | |
| interview1.pdf | 2018-08-27 12:27 | 579K | |
| interview11.pdf | 2018-08-27 12:27 | 1.8M | |
| interview_dst.pdf | 2018-08-27 12:27 | 1.8M | |
| interview_semi-skilled.pdf | 2018-08-27 12:25 | 1.9M | |
| interview_sps.pdf | 2018-08-27 12:27 | 590K | |
| interviewc.pdf | 2018-08-27 12:27 | 219K | |
| iprra.pdf | 2018-08-27 12:27 | 141K | |
| irc17.pdf | 2018-08-27 12:25 | 423K | |
| isoaward.pdf | 2018-08-27 12:25 | 225K | |
| issgpu.pdf | 2018-08-27 12:25 | 4.2M | |
| ivision.pdf | 2018-08-27 12:25 | 2.6M | |
| jao.pdf | 2018-08-27 12:27 | 411K | |
| jao1.pdf | 2018-08-27 12:26 | 553K | |
| je.pdf | 2018-08-27 12:25 | 99K | |
| jrfne.pdf | 2018-08-27 12:26 | 926K | |
| kamdhenumou.pdf | 2018-08-27 12:27 | 280K | |
| kgururaj.pdf | 2018-08-27 12:27 | 30K | |
| kharche.pdf | 2018-08-27 12:27 | 174K | |
| kidwai_award.pdf | 2018-08-27 12:25 | 387K | |
| kisanmela2018.pdf | 2018-08-27 12:26 | 476K | |
| kisannews.pdf | 2018-08-27 12:25 | 1.5M | |
| library2018.pdf | 2018-12-29 12:29 | 371K | |
| limited2015.pdf | 2018-08-27 12:27 | 321K | |
| listofparticipant23-30vov17.pdf | 2018-08-27 12:25 | 464K | |
| madicalofficer.pdf | 2018-08-27 12:27 | 179K | |
| madico.pdf | 2018-08-27 12:27 | 92K | |
| medicalofficer.pdf | 2018-08-27 12:27 | 113K | |
| microbee.pdf | 2018-08-27 12:25 | 383K | |
| mksaward.pdf | 2018-08-27 12:27 | 380K | |
| mksingh.pdf | 2018-08-27 12:27 | 54K | |
| mmproduct2018.jpg | 2018-08-27 12:27 | 93K | |
| moringanews.pdf | 2018-08-27 12:27 | 209K | |
| moukamdhenu.pdf | 2018-08-27 12:25 | 907K | |
| msc-18.pdf | 2018-08-27 12:27 | 691K | |
| mscdeser.doc | 2018-08-27 12:27 | 22K | |
| mycobactin.pdf | 2018-08-27 12:27 | 1.3M | |
| naipc3_1.pdf | 2018-08-27 12:27 | 65K | |
| naipc3_2.pdf | 2018-08-27 12:27 | 28K | |
| naipc3_3.pdf | 2018-08-27 12:27 | 50K | |
| naipc4.pdf | 2018-08-27 12:25 | 168K | |
| nasf-srf.pdf | 2018-08-27 12:25 | 970K | |
| neelami.pdf | 2018-08-27 12:27 | 956K | |
| new.gif | 2018-08-27 12:26 | 2.4K | |
| new1.gif | 2018-08-27 12:25 | 2.3K | |
| newinterview.pdf | 2018-12-29 10:26 | 431K | |
| news.pdf | 2020-03-19 13:00 | 261K | |
| news14.pdf | 2018-08-27 12:25 | 22M | |
| newsdengu.pdf | 2018-08-27 12:25 | 285K | |
| nfbsfraproject15-16.pdf | 2018-08-27 12:26 | 35K | |
| nicra-15.pdf | 2018-08-27 12:25 | 6.3M | |
| nicra_tender_2016.pdf | 2018-08-27 12:27 | 6.3M | |
| notice-22.pdf | 2022-02-17 16:52 | 380K | |
| notice_visitors.pdf | 2022-02-21 12:20 | 237K | |
| ntp80th.pdf | 2019-01-09 17:01 | 216K | |
| open_e_tender16_17.pdf | 2018-08-27 12:25 | 6.5M | |
| parivartanyatra.pdf | 2018-08-27 12:27 | 24K | |
| patent grant 1.pdf | 2020-07-13 12:46 | 665K | |
| patent grant 2.pdf | 2020-07-13 12:22 | 666K | |
| patent grant 3.pdf | 2020-07-20 14:19 | 666K | |
| pcrasrf.pdf | 2018-08-27 12:25 | 542K | |
| pcsrfra.pdf | 2018-08-27 12:27 | 661K | |
| pemplate.pdf | 2018-08-27 12:25 | 485K | |
| pet.pdf | 2018-08-27 12:27 | 246K | |
| pgh.pdf | 2018-08-27 12:27 | 268K | |
| pkrout.pdf | 2018-08-27 12:27 | 89K | |
| pme-yp1.pdf | 2018-08-27 12:27 | 1.2M | |
| pme.pdf | 2018-08-27 12:25 | 68K | |
| project/ | 2019-11-20 12:42 | - | |
| publication15.pdf | 2018-08-27 12:27 | 357K | |
| rai.pdf | 2018-08-27 12:27 | 34K | |
| rajbhasa.pdf | 2018-08-27 12:25 | 134K | |
| raopz.pdf | 2018-08-27 12:27 | 388K | |
| rarout.pdf | 2018-08-27 12:25 | 14K | |
| rasoor.pdf | 2018-08-27 12:25 | 81K | |
| rasrf.pdf | 2018-08-27 12:27 | 396K | |
| rasvs.pdf | 2018-08-27 12:25 | 149K | |
| rathore.pdf | 2018-08-27 12:25 | 870K | |
| ravi.pdf | 2018-08-27 12:27 | 130K | |
| ravindra.pdf | 2018-08-27 12:27 | 122K | |
| recorderer.pdf | 2018-08-27 12:27 | 93K | |
| report_WD_2022.pdf | 2022-03-11 12:28 | 504K | |
| repository/ | 2020-02-20 14:48 | - | |
| resheduledyp1.pdf | 2018-08-27 12:27 | 1.3M | |
| resume/ | 2019-09-07 11:24 | - | |
| revisedyp1.pdf | 2018-08-27 12:25 | 519K | |
| rfd.pdf | 2018-08-27 12:25 | 147K | |
| rfd11-12.pdf | 2018-08-27 12:27 | 147K | |
| rfd12-13.pdf | 2018-08-27 12:27 | 191K | |
| rfd13-14.pdf | 2018-08-27 12:26 | 66K | |
| rfd2013-14-final-cirg.pdf | 2018-08-27 12:27 | 152K | |
| rfd2014-15.pdf | 2018-08-27 12:25 | 197K | |
| roopsingh.jpg | 2018-08-27 12:27 | 779K | |
| roopsingh1.pdf | 2018-08-27 12:27 | 651K | |
| rti.1.pdf | 2019-11-20 15:07 | 80K | |
| rti.2.pdf | 2019-11-20 15:24 | 96K | |
| rtidetails.pdf | 2018-08-27 12:25 | 270K | |
| rvs.pdf | 2018-08-27 12:27 | 275K | |
| saket.pdf | 2018-08-27 12:27 | 166K | |
| salectedtrainee56.pdf | 2018-08-27 12:27 | 140K | |
| schedule-vo.pdf | 2018-08-27 12:25 | 1.1M | |
| scientis | 2018-08-27 12:25 | 438K | |
| scientist/ | 2023-08-28 10:23 | - | |
| scientists | 2018-08-27 12:25 | 97K | |
| scsp2019.pdf | 2019-02-27 10:51 | 6.7M | |
| sdk.pdf | 2018-08-27 12:27 | 231K | |
| sdk1.pdf | 2018-08-27 12:25 | 179K | |
| security.pdf | 2018-08-27 12:25 | 273K | |
| serb1.pdf | 2018-08-27 12:27 | 6.4M | |
| shiva.pdf | 2018-08-27 12:27 | 514K | |
| sirohi.pdf | 2018-08-27 12:27 | 31K | |
| skji.pdf | 2018-08-27 12:27 | 32K | |
| souvik.pdf | 2018-08-27 12:27 | 340K | |
| spsingh.pdf | 2018-08-27 12:27 | 197K | |
| srf-dbt.pdf | 2018-08-27 12:27 | 1.6M | |
| srf24june.pdf | 2018-08-27 12:27 | 2.9M | |
| srf_walkin.pdf | 2018-08-27 12:27 | 2.3M | |
| suman.pdf | 2018-08-27 12:27 | 197K | |
| swachhbharat.pdf | 2018-08-27 12:27 | 868K | |
| swachhta.pdf | 2018-08-27 12:27 | 330K | |
| tele.pdf | 2018-08-27 12:27 | 351K | |
| tele_16.pdf | 2018-08-27 12:26 | 158K | |
| tele_update-august-16.pdf | 2018-08-27 12:27 | 106K | |
| tele_update.pdf | 2018-08-27 12:27 | 121K | |
| tele_updated.pdf | 2018-08-27 12:25 | 120K | |
| telephone.pdf | 2018-08-27 12:25 | 336K | |
| telephone16.pdf | 2018-08-27 12:27 | 158K | |
| telephone_update-12th-august-16.pdf | 2018-08-27 12:27 | 163K | |
| tenbhosa.pdf | 2018-08-27 12:27 | 20K | |
| tendar.pdf | 2018-12-03 10:20 | 250K | |
| tender | 2018-08-27 12:27 | 50K | |
| tender-feed-2016.pdf | 2018-08-27 12:25 | 315K | |
| tender-nicra16.pdf | 2018-08-27 12:27 | 6.4M | |
| tender_feed.pdf | 2018-08-27 12:25 | 419K | |
| tender_serb.pdf | 2018-08-27 12:25 | 13M | |
| tender_vediofilm.pdf | 2018-08-27 12:27 | 89K | |
| tenderproject.pdf | 2018-08-27 12:27 | 484K | |
| tenders/ | 2018-08-27 12:25 | - | |
| timahi_cal.pdf | 2018-08-27 12:25 | 109K | |
| trainee-vo.pdf | 2018-08-27 12:27 | 73K | |
| trainee.pdf | 2018-08-27 12:26 | 158K | |
| training/ | 2024-01-11 15:25 | - | |
| training1.pdf | 2018-08-27 12:25 | 97K | |
| trainings | 2018-08-27 12:25 | 229K | |
| trainpraposed.pdf | 2018-08-27 12:27 | 37K | |
| ub.pdf | 2018-08-27 12:27 | 70K | |
| uknews.pdf | 2018-08-27 12:27 | 762K | |
| unskilled-barbari.pdf | 2018-08-27 12:27 | 307K | |
| vijay.pdf | 2018-08-27 12:27 | 126K | |
| vision30.pdf | 2018-08-27 12:27 | 611K | |
| vision2050.pdf | 2018-08-27 12:25 | 924K | |
| vo_t6.pdf | 2018-08-27 12:27 | 107K | |
| vraj.pdf | 2018-08-27 12:27 | 56K | |
| walk-in-2016.pdf | 2018-08-27 12:25 | 326K | |
| walk-withdrawn2016.pdf | 2018-08-27 12:27 | 2.4M | |
| walk.doc | 2018-08-27 12:25 | 68K | |
| walk.pdf | 2018-08-27 12:27 | 160K | |
| walk1.pdf | 2018-08-27 12:27 | 106K | |
| walkin-aicrp.pdf | 2018-08-27 12:27 | 503K | |
| walkinaugust17.pdf | 2018-08-27 12:27 | 4.4M | |
| walk in interview/ | 2024-01-05 16:00 | - | |
| walkrevi.pdf | 2018-08-27 12:27 | 106K | |
| webunskilled.pdf | 2018-08-27 12:27 | 218K | |
| yatra.pdf | 2018-08-27 12:27 | 279K | |
| young.pdf | 2018-08-27 12:25 | 10K | |
| yp.pdf | 2019-02-14 11:52 | 737K | |
| yp1vtcc.pdf | 2018-08-27 12:27 | 446K | |
| ypImkt.pdf | 2018-08-27 12:27 | 491K | |
| yp_2022.pdf | 2022-04-06 19:32 | 2.4M | |
| ypaicrp.pdf | 2018-08-27 12:27 | 303K | |
| ypakmu.pdf | 2018-08-27 12:25 | 2.1M | |
| ypca.pdf | 2018-08-27 12:25 | 290K | |
| ypca2015.pdf | 2018-08-27 12:27 | 290K | |
| ypnaif.pdf | 2018-08-27 12:25 | 2.0M | |
| ypsvs.pdf | 2018-08-27 12:27 | 324K | |